C17H17BrN2O3 — CID 7818419
(2R)-2-(3-bromophenoxy)-N-(ethylcarbamoyl)-2-phenylacetamide (PubChem CID 7818419) has the molecular formula C17H17BrN2O3 and a molecular weight of 377.24 g/mol. Its IUPAC name is (2R)-2-(3-bromophenoxy)-N-(ethylcarbamoyl)-2-phenylacetamide.
| Compound Name | (2R)-2-(3-bromophenoxy)-N-(ethylcarbamoyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 7818419 |
| Molecular Formula | C17H17BrN2O3 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | (2R)-2-(3-bromophenoxy)-N-(ethylcarbamoyl)-2-phenylacetamide |
| SMILES | CCNC(=O)NC(=O)[C@H](Oc1cccc(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C17H17BrN2O3/c1-2-19-17(22)20-16(21)15(12-7-4-3-5-8-12)23-14-10-6-9-13(18)11-14/h3-11,15H,2H2,1H3,(H2,19,20,21,22)/t15-/m1/s1 |
| InChIKey | JAZYHWXEZVCWHP-OAHLLOKOSA-N |
| XLogP | 3.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |