C17H19ClN3O2+ — CID 8599214
[(1S)-2-(carbamoylamino)-2-oxo-1-phenylethyl]-[(1R)-1-(3-chlorophenyl)ethyl]azanium (PubChem CID 8599214) has the molecular formula C17H19ClN3O2+ and a molecular weight of 332.81 g/mol. Its IUPAC name is [(1S)-2-(carbamoylamino)-2-oxo-1-phenylethyl]-[(1R)-1-(3-chlorophenyl)ethyl]azanium.
| Compound Name | [(1S)-2-(carbamoylamino)-2-oxo-1-phenylethyl]-[(1R)-1-(3-chlorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 8599214 |
| Molecular Formula | C17H19ClN3O2+ |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | [(1S)-2-(carbamoylamino)-2-oxo-1-phenylethyl]-[(1R)-1-(3-chlorophenyl)ethyl]azanium |
| SMILES | C[C@@H]([NH2+][C@H](C(=O)NC(N)=O)c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H18ClN3O2/c1-11(13-8-5-9-14(18)10-13)20-15(16(22)21-17(19)23)12-6-3-2-4-7-12/h2-11,15,20H,1H3,(H3,19,21,22,23)/p+1/t11-,15+/m1/s1 |
| InChIKey | QJWZXWHMJDHVGI-ABAIWWIYSA-O |
| XLogP | 1.90 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |