C13H18ClN2O3+ — CID 8599390
[(1S)-1-(3-chlorophenyl)ethyl]-[(2S)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]azanium (PubChem CID 8599390) has the molecular formula C13H18ClN2O3+ and a molecular weight of 285.75 g/mol. Its IUPAC name is [(1S)-1-(3-chlorophenyl)ethyl]-[(2S)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]azanium.
| Compound Name | [(1S)-1-(3-chlorophenyl)ethyl]-[(2S)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 8599390 |
| Molecular Formula | C13H18ClN2O3+ |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | [(1S)-1-(3-chlorophenyl)ethyl]-[(2S)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]azanium |
| SMILES | COC(=O)NC(=O)[C@H](C)[NH2+][C@@H](C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H17ClN2O3/c1-8(10-5-4-6-11(14)7-10)15-9(2)12(17)16-13(18)19-3/h4-9,15H,1-3H3,(H,16,17,18)/p+1/t8-,9-/m0/s1 |
| InChIKey | ZMYYLPHYBSFVBN-IUCAKERBSA-O |
| XLogP | 1.24 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |