C17H18Cl3N2O+ — CID 2576614
[(2S)-1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl]-[(1R)-1-phenylethyl]azanium (PubChem CID 2576614) has the molecular formula C17H18Cl3N2O+ and a molecular weight of 372.70 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl]-[(1R)-1-phenylethyl]azanium.
| Compound Name | [(2S)-1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl]-[(1R)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 2576614 |
| Molecular Formula | C17H18Cl3N2O+ |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | [(2S)-1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl]-[(1R)-1-phenylethyl]azanium |
| SMILES | C[C@H]([NH2+][C@H](C)c1ccccc1)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H17Cl3N2O/c1-10(12-6-4-3-5-7-12)21-11(2)17(23)22-16-9-14(19)13(18)8-15(16)20/h3-11,21H,1-2H3,(H,22,23)/p+1/t10-,11+/m1/s1 |
| InChIKey | MPAUIXLAVDZIEW-MNOVXSKESA-O |
| XLogP | 4.30 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|