C19H23ClN3O2+ — CID 9451661
[(2S)-1-(4-acetamidoanilino)-1-oxopropan-2-yl]-[(1S)-1-(4-chlorophenyl)ethyl]azanium (PubChem CID 9451661) has the molecular formula C19H23ClN3O2+ and a molecular weight of 360.87 g/mol. Its IUPAC name is [(2S)-1-(4-acetamidoanilino)-1-oxopropan-2-yl]-[(1S)-1-(4-chlorophenyl)ethyl]azanium.
| Compound Name | [(2S)-1-(4-acetamidoanilino)-1-oxopropan-2-yl]-[(1S)-1-(4-chlorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9451661 |
| Molecular Formula | C19H23ClN3O2+ |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [(2S)-1-(4-acetamidoanilino)-1-oxopropan-2-yl]-[(1S)-1-(4-chlorophenyl)ethyl]azanium |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@H](C)[NH2+][C@@H](C)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-12(15-4-6-16(20)7-5-15)21-13(2)19(25)23-18-10-8-17(9-11-18)22-14(3)24/h4-13,21H,1-3H3,(H,22,24)(H,23,25)/p+1/t12-,13-/m0/s1 |
| InChIKey | UDARDGYDBFRYCI-STQMWFEESA-O |
| XLogP | 2.95 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |