C21H30ClN2O+ — CID 9334846
[(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl]-[(1R)-1-(4-chlorophenyl)ethyl]azanium (PubChem CID 9334846) has the molecular formula C21H30ClN2O+ and a molecular weight of 361.94 g/mol. Its IUPAC name is [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl]-[(1R)-1-(4-chlorophenyl)ethyl]azanium.
| Compound Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl]-[(1R)-1-(4-chlorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9334846 |
| Molecular Formula | C21H30ClN2O+ |
| Molecular Weight | 361.94 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl]-[(1R)-1-(4-chlorophenyl)ethyl]azanium |
| SMILES | C[C@H]([NH2+][C@H](C)c1ccc(Cl)cc1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H29ClN2O/c1-13(18-3-5-19(22)6-4-18)23-14(2)20(25)24-21-10-15-7-16(11-21)9-17(8-15)12-21/h3-6,13-17,23H,7-12H2,1-2H3,(H,24,25)/p+1/t13-,14+,15?,16?,17?,21?/m1/s1 |
| InChIKey | AZMYNWXTITVXMZ-QZWKJPRYSA-O |
| XLogP | 3.44 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.94 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |