C19H24ClNOS — CID 7816486
(2S)-N-(1-adamantyl)-2-(4-chlorophenyl)sulfanylpropanamide (PubChem CID 7816486) has the molecular formula C19H24ClNOS and a molecular weight of 349.93 g/mol. Its IUPAC name is (2S)-N-(1-adamantyl)-2-(4-chlorophenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-(1-adamantyl)-2-(4-chlorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 7816486 |
| Molecular Formula | C19H24ClNOS |
| Molecular Weight | 349.93 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (2S)-N-(1-adamantyl)-2-(4-chlorophenyl)sulfanylpropanamide |
| SMILES | C[C@H](Sc1ccc(Cl)cc1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H24ClNOS/c1-12(23-17-4-2-16(20)3-5-17)18(22)21-19-9-13-6-14(10-19)8-15(7-13)11-19/h2-5,12-15H,6-11H2,1H3,(H,21,22)/t12-,13?,14?,15?,19?/m0/s1 |
| InChIKey | WAOWDWDYYPCOGX-UHSVVUDUSA-N |
| XLogP | 4.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.93 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |