C20H24N2OS2 — CID 7756895
(2S)-N-(1-adamantyl)-2-(1,3-benzothiazol-2-ylsulfanyl)propanamide (PubChem CID 7756895) has the molecular formula C20H24N2OS2 and a molecular weight of 372.56 g/mol. Its IUPAC name is (2S)-N-(1-adamantyl)-2-(1,3-benzothiazol-2-ylsulfanyl)propanamide.
| Compound Name | (2S)-N-(1-adamantyl)-2-(1,3-benzothiazol-2-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 7756895 |
| Molecular Formula | C20H24N2OS2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (2S)-N-(1-adamantyl)-2-(1,3-benzothiazol-2-ylsulfanyl)propanamide |
| SMILES | C[C@H](Sc1nc2ccccc2s1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H24N2OS2/c1-12(24-19-21-16-4-2-3-5-17(16)25-19)18(23)22-20-9-13-6-14(10-20)8-15(7-13)11-20/h2-5,12-15H,6-11H2,1H3,(H,22,23)/t12-,13?,14?,15?,20?/m0/s1 |
| InChIKey | HUFDIAVPBKDGMU-PGBBXINNSA-N |
| XLogP | 4.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |