C20H30N3O3+ — CID 8921741
[(2R)-1-(1-adamantylcarbamoylamino)-1-oxopropan-2-yl]-[(1S)-1-(furan-2-yl)ethyl]azanium (PubChem CID 8921741) has the molecular formula C20H30N3O3+ and a molecular weight of 360.48 g/mol. Its IUPAC name is [(2R)-1-(1-adamantylcarbamoylamino)-1-oxopropan-2-yl]-[(1S)-1-(furan-2-yl)ethyl]azanium.
| Compound Name | [(2R)-1-(1-adamantylcarbamoylamino)-1-oxopropan-2-yl]-[(1S)-1-(furan-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8921741 |
| Molecular Formula | C20H30N3O3+ |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(2R)-1-(1-adamantylcarbamoylamino)-1-oxopropan-2-yl]-[(1S)-1-(furan-2-yl)ethyl]azanium |
| SMILES | C[C@H]([NH2+][C@H](C)C(=O)NC(=O)NC12CC3CC(CC(C3)C1)C2)c1ccco1 |
| InChI | InChI=1S/C20H29N3O3/c1-12(17-4-3-5-26-17)21-13(2)18(24)22-19(25)23-20-9-14-6-15(10-20)8-16(7-14)11-20/h3-5,12-16,21H,6-11H2,1-2H3,(H2,22,23,24,25)/p+1/t12-,13+,14?,15?,16?,20?/m0/s1 |
| InChIKey | WMFQHVRZTHKQHI-NSYBLIORSA-O |
| XLogP | 2.09 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |