C24H30N2O2 — CID 8755398
(2S)-N-(1-adamantyl)-2-[[(R)-furan-2-yl(phenyl)methyl]amino]propanamide (PubChem CID 8755398) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (2S)-N-(1-adamantyl)-2-[[(R)-furan-2-yl(phenyl)methyl]amino]propanamide.
| Compound Name | (2S)-N-(1-adamantyl)-2-[[(R)-furan-2-yl(phenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 8755398 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (2S)-N-(1-adamantyl)-2-[[(R)-furan-2-yl(phenyl)methyl]amino]propanamide |
| SMILES | C[C@H](N[C@H](c1ccccc1)c1ccco1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H30N2O2/c1-16(25-22(21-8-5-9-28-21)20-6-3-2-4-7-20)23(27)26-24-13-17-10-18(14-24)12-19(11-17)15-24/h2-9,16-19,22,25H,10-15H2,1H3,(H,26,27)/t16-,17?,18?,19?,22+,24?/m0/s1 |
| InChIKey | BYHTWWBUXMWXFD-PYXPVNFYSA-N |
| XLogP | 4.43 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |