C23H34N3O3+ — CID 9347687
[(2R)-1-(1-adamantylcarbamoylamino)-1-oxopropan-2-yl]-methyl-(2-phenoxyethyl)azanium (PubChem CID 9347687) has the molecular formula C23H34N3O3+ and a molecular weight of 400.54 g/mol. Its IUPAC name is [(2R)-1-(1-adamantylcarbamoylamino)-1-oxopropan-2-yl]-methyl-(2-phenoxyethyl)azanium.
| Compound Name | [(2R)-1-(1-adamantylcarbamoylamino)-1-oxopropan-2-yl]-methyl-(2-phenoxyethyl)azanium |
|---|---|
| PubChem CID | 9347687 |
| Molecular Formula | C23H34N3O3+ |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [(2R)-1-(1-adamantylcarbamoylamino)-1-oxopropan-2-yl]-methyl-(2-phenoxyethyl)azanium |
| SMILES | C[C@H](C(=O)NC(=O)NC12CC3CC(CC(C3)C1)C2)[NH+](C)CCOc1ccccc1 |
| InChI | InChI=1S/C23H33N3O3/c1-16(26(2)8-9-29-20-6-4-3-5-7-20)21(27)24-22(28)25-23-13-17-10-18(14-23)12-19(11-17)15-23/h3-7,16-19H,8-15H2,1-2H3,(H2,24,25,27,28)/p+1/t16-,17?,18?,19?,23?/m1/s1 |
| InChIKey | CRKLYQBEYHWHJG-DNBYOKIBSA-O |
| XLogP | 1.76 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |