C23H35N2O2+ — CID 8515355
[(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl]-[(4-ethoxyphenyl)methyl]-methylazanium (PubChem CID 8515355) has the molecular formula C23H35N2O2+ and a molecular weight of 371.55 g/mol. Its IUPAC name is [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl]-[(4-ethoxyphenyl)methyl]-methylazanium.
| Compound Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl]-[(4-ethoxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8515355 |
| Molecular Formula | C23H35N2O2+ |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.27 |
| IUPAC Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl]-[(4-ethoxyphenyl)methyl]-methylazanium |
| SMILES | CCOc1ccc(C[NH+](C)[C@@H](C)C(=O)NC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H34N2O2/c1-4-27-21-7-5-17(6-8-21)15-25(3)16(2)22(26)24-23-12-18-9-19(13-23)11-20(10-18)14-23/h5-8,16,18-20H,4,9-15H2,1-3H3,(H,24,26)/p+1/t16-,18?,19?,20?,23?/m0/s1 |
| InChIKey | PPPPQFCIXYOGGU-KTIUQTLCSA-O |
| XLogP | 2.57 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |