C20H27F2N2O+ — CID 9376217
[2-(1-adamantylamino)-2-oxoethyl]-[(1S)-1-(3,4-difluorophenyl)ethyl]azanium (PubChem CID 9376217) has the molecular formula C20H27F2N2O+ and a molecular weight of 349.44 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl]-[(1S)-1-(3,4-difluorophenyl)ethyl]azanium.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl]-[(1S)-1-(3,4-difluorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9376217 |
| Molecular Formula | C20H27F2N2O+ |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl]-[(1S)-1-(3,4-difluorophenyl)ethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)NC12CC3CC(CC(C3)C1)C2)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H26F2N2O/c1-12(16-2-3-17(21)18(22)7-16)23-11-19(25)24-20-8-13-4-14(9-20)6-15(5-13)10-20/h2-3,7,12-15,23H,4-6,8-11H2,1H3,(H,24,25)/p+1/t12-,13?,14?,15?,20?/m0/s1 |
| InChIKey | ZFYKMMPHGJPNIC-PGBBXINNSA-O |
| XLogP | 2.67 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |