C21H29ClN3O2+ — CID 9307413
[2-(1-adamantylcarbamoylamino)-2-oxoethyl]-[(1R)-1-(3-chlorophenyl)ethyl]azanium (PubChem CID 9307413) has the molecular formula C21H29ClN3O2+ and a molecular weight of 390.94 g/mol. Its IUPAC name is [2-(1-adamantylcarbamoylamino)-2-oxoethyl]-[(1R)-1-(3-chlorophenyl)ethyl]azanium.
| Compound Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl]-[(1R)-1-(3-chlorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9307413 |
| Molecular Formula | C21H29ClN3O2+ |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl]-[(1R)-1-(3-chlorophenyl)ethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)NC(=O)NC12CC3CC(CC(C3)C1)C2)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H28ClN3O2/c1-13(17-3-2-4-18(22)8-17)23-12-19(26)24-20(27)25-21-9-14-5-15(10-21)7-16(6-14)11-21/h2-4,8,13-16,23H,5-7,9-12H2,1H3,(H2,24,25,26,27)/p+1/t13-,14?,15?,16?,21?/m1/s1 |
| InChIKey | KANHLLQACPCAAD-BUBBNXEVSA-O |
| XLogP | 2.76 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |