C17H18ClFN3O2+ — CID 9307671
[(1S)-1-(3-chlorophenyl)ethyl]-[2-[(2-fluorophenyl)carbamoylamino]-2-oxoethyl]azanium (PubChem CID 9307671) has the molecular formula C17H18ClFN3O2+ and a molecular weight of 350.80 g/mol. Its IUPAC name is [(1S)-1-(3-chlorophenyl)ethyl]-[2-[(2-fluorophenyl)carbamoylamino]-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(3-chlorophenyl)ethyl]-[2-[(2-fluorophenyl)carbamoylamino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9307671 |
| Molecular Formula | C17H18ClFN3O2+ |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | [(1S)-1-(3-chlorophenyl)ethyl]-[2-[(2-fluorophenyl)carbamoylamino]-2-oxoethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)NC(=O)Nc1ccccc1F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H17ClFN3O2/c1-11(12-5-4-6-13(18)9-12)20-10-16(23)22-17(24)21-15-8-3-2-7-14(15)19/h2-9,11,20H,10H2,1H3,(H2,21,22,23,24)/p+1/t11-/m0/s1 |
| InChIKey | GPLDZROJWZTZFQ-NSHDSACASA-O |
| XLogP | 2.45 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |