C19H24ClN2O+ — CID 8599384
[(1R)-1-(3-chlorophenyl)ethyl]-[2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl]azanium (PubChem CID 8599384) has the molecular formula C19H24ClN2O+ and a molecular weight of 331.87 g/mol. Its IUPAC name is [(1R)-1-(3-chlorophenyl)ethyl]-[2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(3-chlorophenyl)ethyl]-[2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8599384 |
| Molecular Formula | C19H24ClN2O+ |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | [(1R)-1-(3-chlorophenyl)ethyl]-[2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl]azanium |
| SMILES | Cc1ccccc1CCNC(=O)C[NH2+][C@H](C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H23ClN2O/c1-14-6-3-4-7-16(14)10-11-21-19(23)13-22-15(2)17-8-5-9-18(20)12-17/h3-9,12,15,22H,10-11,13H2,1-2H3,(H,21,23)/p+1/t15-/m1/s1 |
| InChIKey | QOPZHHFESDHNHO-OAHLLOKOSA-O |
| XLogP | 2.63 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |