C18H22ClN2O+ — CID 8599402
[(1S)-1-(3-chlorophenyl)ethyl]-[2-[(2-methylphenyl)methylamino]-2-oxoethyl]azanium (PubChem CID 8599402) has the molecular formula C18H22ClN2O+ and a molecular weight of 317.84 g/mol. Its IUPAC name is [(1S)-1-(3-chlorophenyl)ethyl]-[2-[(2-methylphenyl)methylamino]-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(3-chlorophenyl)ethyl]-[2-[(2-methylphenyl)methylamino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8599402 |
| Molecular Formula | C18H22ClN2O+ |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | [(1S)-1-(3-chlorophenyl)ethyl]-[2-[(2-methylphenyl)methylamino]-2-oxoethyl]azanium |
| SMILES | Cc1ccccc1CNC(=O)C[NH2+][C@@H](C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H21ClN2O/c1-13-6-3-4-7-16(13)11-21-18(22)12-20-14(2)15-8-5-9-17(19)10-15/h3-10,14,20H,11-12H2,1-2H3,(H,21,22)/p+1/t14-/m0/s1 |
| InChIKey | XIHITCURDFCOMJ-AWEZNQCLSA-O |
| XLogP | 2.59 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |