C18H20Cl2N3O3+ — CID 8710396
[2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-[(1S)-1-(3-chlorophenyl)ethyl]azanium (PubChem CID 8710396) has the molecular formula C18H20Cl2N3O3+ and a molecular weight of 397.28 g/mol. Its IUPAC name is [2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-[(1S)-1-(3-chlorophenyl)ethyl]azanium.
| Compound Name | [2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-[(1S)-1-(3-chlorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 8710396 |
| Molecular Formula | C18H20Cl2N3O3+ |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | [2-[2-[2-(4-chlorophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-[(1S)-1-(3-chlorophenyl)ethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)NNC(=O)COc1ccc(Cl)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H19Cl2N3O3/c1-12(13-3-2-4-15(20)9-13)21-10-17(24)22-23-18(25)11-26-16-7-5-14(19)6-8-16/h2-9,12,21H,10-11H2,1H3,(H,22,24)(H,23,25)/p+1/t12-/m0/s1 |
| InChIKey | NUAPXFYTJLIXTH-LBPRGKRZSA-O |
| XLogP | 1.84 |
| TPSA | 84.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|