C15H17ClN3O3+ — CID 8599162
[(1S)-1-(3-chlorophenyl)ethyl]-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]azanium (PubChem CID 8599162) has the molecular formula C15H17ClN3O3+ and a molecular weight of 322.77 g/mol. Its IUPAC name is [(1S)-1-(3-chlorophenyl)ethyl]-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(3-chlorophenyl)ethyl]-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8599162 |
| Molecular Formula | C15H17ClN3O3+ |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | [(1S)-1-(3-chlorophenyl)ethyl]-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)NNC(=O)c1ccco1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H16ClN3O3/c1-10(11-4-2-5-12(16)8-11)17-9-14(20)18-19-15(21)13-6-3-7-22-13/h2-8,10,17H,9H2,1H3,(H,18,20)(H,19,21)/p+1/t10-/m0/s1 |
| InChIKey | GKTCMCBEMNSUPN-JTQLQIEISA-O |
| XLogP | 1.02 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|