C20H28N3O3+ — CID 8970450
[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]-[(1S)-2-methyl-1-(4-propylphenyl)propyl]azanium (PubChem CID 8970450) has the molecular formula C20H28N3O3+ and a molecular weight of 358.46 g/mol. Its IUPAC name is [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]-[(1S)-2-methyl-1-(4-propylphenyl)propyl]azanium.
| Compound Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]-[(1S)-2-methyl-1-(4-propylphenyl)propyl]azanium |
|---|---|
| PubChem CID | 8970450 |
| Molecular Formula | C20H28N3O3+ |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]-[(1S)-2-methyl-1-(4-propylphenyl)propyl]azanium |
| SMILES | CCCc1ccc([C@@H]([NH2+]CC(=O)NNC(=O)c2ccco2)C(C)C)cc1 |
| InChI | InChI=1S/C20H27N3O3/c1-4-6-15-8-10-16(11-9-15)19(14(2)3)21-13-18(24)22-23-20(25)17-7-5-12-26-17/h5,7-12,14,19,21H,4,6,13H2,1-3H3,(H,22,24)(H,23,25)/p+1/t19-/m0/s1 |
| InChIKey | XXHDIHRMWLIZQZ-IBGZPJMESA-O |
| XLogP | 1.95 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|