C21H29N3O3 — CID 8995988
N'-[2-[[(1S)-2-methyl-1-[4-(2-methylpropyl)phenyl]propyl]amino]acetyl]furan-2-carbohydrazide (PubChem CID 8995988) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is N'-[2-[[(1S)-2-methyl-1-[4-(2-methylpropyl)phenyl]propyl]amino]acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[[(1S)-2-methyl-1-[4-(2-methylpropyl)phenyl]propyl]amino]acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 8995988 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N'-[2-[[(1S)-2-methyl-1-[4-(2-methylpropyl)phenyl]propyl]amino]acetyl]furan-2-carbohydrazide |
| SMILES | CC(C)Cc1ccc([C@@H](NCC(=O)NNC(=O)c2ccco2)C(C)C)cc1 |
| InChI | InChI=1S/C21H29N3O3/c1-14(2)12-16-7-9-17(10-8-16)20(15(3)4)22-13-19(25)23-24-21(26)18-6-5-11-27-18/h5-11,14-15,20,22H,12-13H2,1-4H3,(H,23,25)(H,24,26)/t20-/m0/s1 |
| InChIKey | YFRXTGYEMKQJDB-FQEVSTJZSA-N |
| XLogP | 3.23 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|