C22H25N3O3S — CID 8996622
N'-[2-[[(S)-[4-[(2S)-butan-2-yl]phenyl]-thiophen-2-ylmethyl]amino]acetyl]furan-2-carbohydrazide (PubChem CID 8996622) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is N'-[2-[[(S)-[4-[(2S)-butan-2-yl]phenyl]-thiophen-2-ylmethyl]amino]acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[[(S)-[4-[(2S)-butan-2-yl]phenyl]-thiophen-2-ylmethyl]amino]acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 8996622 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N'-[2-[[(S)-[4-[(2S)-butan-2-yl]phenyl]-thiophen-2-ylmethyl]amino]acetyl]furan-2-carbohydrazide |
| SMILES | CC[C@H](C)c1ccc([C@H](NCC(=O)NNC(=O)c2ccco2)c2cccs2)cc1 |
| InChI | InChI=1S/C22H25N3O3S/c1-3-15(2)16-8-10-17(11-9-16)21(19-7-5-13-29-19)23-14-20(26)24-25-22(27)18-6-4-12-28-18/h4-13,15,21,23H,3,14H2,1-2H3,(H,24,26)(H,25,27)/t15-,21-/m0/s1 |
| InChIKey | GLCPMUSRDUKRPD-BTYIYWSLSA-N |
| XLogP | 3.99 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|