C23H26N2OS — CID 8997932
N-benzyl-2-[[(S)-(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]amino]acetamide (PubChem CID 8997932) has the molecular formula C23H26N2OS and a molecular weight of 378.54 g/mol. Its IUPAC name is N-benzyl-2-[[(S)-(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]amino]acetamide.
| Compound Name | N-benzyl-2-[[(S)-(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]amino]acetamide |
|---|---|
| PubChem CID | 8997932 |
| Molecular Formula | C23H26N2OS |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-benzyl-2-[[(S)-(4-propan-2-ylphenyl)-thiophen-2-ylmethyl]amino]acetamide |
| SMILES | CC(C)c1ccc([C@H](NCC(=O)NCc2ccccc2)c2cccs2)cc1 |
| InChI | InChI=1S/C23H26N2OS/c1-17(2)19-10-12-20(13-11-19)23(21-9-6-14-27-21)25-16-22(26)24-15-18-7-4-3-5-8-18/h3-14,17,23,25H,15-16H2,1-2H3,(H,24,26)/t23-/m0/s1 |
| InChIKey | WTSNJUGEAKFXJZ-QHCPKHFHSA-N |
| XLogP | 4.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |