C21H21ClN2OS — CID 9051553
N-[(1S)-1-(4-chlorophenyl)ethyl]-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]acetamide (PubChem CID 9051553) has the molecular formula C21H21ClN2OS and a molecular weight of 384.93 g/mol. Its IUPAC name is N-[(1S)-1-(4-chlorophenyl)ethyl]-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]acetamide.
| Compound Name | N-[(1S)-1-(4-chlorophenyl)ethyl]-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 9051553 |
| Molecular Formula | C21H21ClN2OS |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-[(1S)-1-(4-chlorophenyl)ethyl]-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]acetamide |
| SMILES | C[C@H](NC(=O)CN[C@H](c1ccccc1)c1cccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClN2OS/c1-15(16-9-11-18(22)12-10-16)24-20(25)14-23-21(19-8-5-13-26-19)17-6-3-2-4-7-17/h2-13,15,21,23H,14H2,1H3,(H,24,25)/t15-,21+/m0/s1 |
| InChIKey | SUXREIBDYQTFQV-YCRPNKLZSA-N |
| XLogP | 4.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |