C21H21FN2OS — CID 18088428
2-[1-(2-fluorophenyl)ethylamino]-N-[phenyl(thiophen-2-yl)methyl]acetamide (PubChem CID 18088428) has the molecular formula C21H21FN2OS and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)ethylamino]-N-[phenyl(thiophen-2-yl)methyl]acetamide.
| Compound Name | 2-[1-(2-fluorophenyl)ethylamino]-N-[phenyl(thiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 18088428 |
| Molecular Formula | C21H21FN2OS |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-[1-(2-fluorophenyl)ethylamino]-N-[phenyl(thiophen-2-yl)methyl]acetamide |
| SMILES | CC(NCC(=O)NC(c1ccccc1)c1cccs1)c1ccccc1F |
| InChI | InChI=1S/C21H21FN2OS/c1-15(17-10-5-6-11-18(17)22)23-14-20(25)24-21(19-12-7-13-26-19)16-8-3-2-4-9-16/h2-13,15,21,23H,14H2,1H3,(H,24,25) |
| InChIKey | VRYODPKSPSXNIO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |