C21H20ClFN2OS — CID 18088222
2-[1-(2-chlorophenyl)ethylamino]-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide (PubChem CID 18088222) has the molecular formula C21H20ClFN2OS and a molecular weight of 402.92 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)ethylamino]-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide.
| Compound Name | 2-[1-(2-chlorophenyl)ethylamino]-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide |
|---|---|
| PubChem CID | 18088222 |
| Molecular Formula | C21H20ClFN2OS |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2-[1-(2-chlorophenyl)ethylamino]-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide |
| SMILES | CC(NCC(=O)NC(c1ccc(F)cc1)c1cccs1)c1ccccc1Cl |
| InChI | InChI=1S/C21H20ClFN2OS/c1-14(17-5-2-3-6-18(17)22)24-13-20(26)25-21(19-7-4-12-27-19)15-8-10-16(23)11-9-15/h2-12,14,21,24H,13H2,1H3,(H,25,26) |
| InChIKey | MCNTTXDRRCROGY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |