C21H19F2N3O4 — CID 8830525
N'-[2-[[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]acetyl]furan-2-carbohydrazide (PubChem CID 8830525) has the molecular formula C21H19F2N3O4 and a molecular weight of 415.40 g/mol. Its IUPAC name is N'-[2-[[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 8830525 |
| Molecular Formula | C21H19F2N3O4 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N'-[2-[[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]acetyl]furan-2-carbohydrazide |
| SMILES | O=C(CN[C@H](c1ccccc1)c1ccc(OC(F)F)cc1)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C21H19F2N3O4/c22-21(23)30-16-10-8-15(9-11-16)19(14-5-2-1-3-6-14)24-13-18(27)25-26-20(28)17-7-4-12-29-17/h1-12,19,21,24H,13H2,(H,25,27)(H,26,28)/t19-/m1/s1 |
| InChIKey | FZXTYKUVWZSKRP-LJQANCHMSA-N |
| XLogP | 3.02 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|