C26H27F2N3O3 — CID 33072186
2-[[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 33072186) has the molecular formula C26H27F2N3O3 and a molecular weight of 467.52 g/mol. Its IUPAC name is 2-[[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 33072186 |
| Molecular Formula | C26H27F2N3O3 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 2-[[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C(CN[C@H](c1ccccc1)c1ccc(OC(F)F)cc1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H27F2N3O3/c27-26(28)34-23-12-6-20(7-13-23)25(19-4-2-1-3-5-19)29-18-24(32)30-21-8-10-22(11-9-21)31-14-16-33-17-15-31/h1-13,25-26,29H,14-18H2,(H,30,32)/t25-/m1/s1 |
| InChIKey | FRVGFYIYPUWKHW-RUZDIDTESA-N |
| XLogP | 4.44 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|