C24H22F2N2O3 — CID 40894967
N-(3-acetylphenyl)-2-[[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]acetamide (PubChem CID 40894967) has the molecular formula C24H22F2N2O3 and a molecular weight of 424.45 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]acetamide |
|---|---|
| PubChem CID | 40894967 |
| Molecular Formula | C24H22F2N2O3 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-(3-acetylphenyl)-2-[[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CN[C@@H](c2ccccc2)c2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C24H22F2N2O3/c1-16(29)19-8-5-9-20(14-19)28-22(30)15-27-23(17-6-3-2-4-7-17)18-10-12-21(13-11-18)31-24(25)26/h2-14,23-24,27H,15H2,1H3,(H,28,30)/t23-/m0/s1 |
| InChIKey | RWNOTQZMLUJEFB-QHCPKHFHSA-N |
| XLogP | 4.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |