C20H24ClN3O2 — CID 8593396
2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 8593396) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is 2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 8593396 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | C[C@H](NCC(=O)Nc1ccc(N2CCOCC2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-15(16-2-4-17(21)5-3-16)22-14-20(25)23-18-6-8-19(9-7-18)24-10-12-26-13-11-24/h2-9,15,22H,10-14H2,1H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | HAVXSKBGEHMADS-HNNXBMFYSA-N |
| XLogP | 3.47 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|