C22H22FN3O3 — CID 8829914
N'-[2-[[(R)-(4-ethylphenyl)-(3-fluorophenyl)methyl]amino]acetyl]furan-2-carbohydrazide (PubChem CID 8829914) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is N'-[2-[[(R)-(4-ethylphenyl)-(3-fluorophenyl)methyl]amino]acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[[(R)-(4-ethylphenyl)-(3-fluorophenyl)methyl]amino]acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 8829914 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N'-[2-[[(R)-(4-ethylphenyl)-(3-fluorophenyl)methyl]amino]acetyl]furan-2-carbohydrazide |
| SMILES | CCc1ccc([C@@H](NCC(=O)NNC(=O)c2ccco2)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C22H22FN3O3/c1-2-15-8-10-16(11-9-15)21(17-5-3-6-18(23)13-17)24-14-20(27)25-26-22(28)19-7-4-12-29-19/h3-13,21,24H,2,14H2,1H3,(H,25,27)(H,26,28)/t21-/m1/s1 |
| InChIKey | WDWJFUMRICYFHX-OAQYLSRUSA-N |
| XLogP | 3.12 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|