C25H26FN3O2 — CID 8719979
N-(4-acetamidophenyl)-2-[[(R)-(4-ethylphenyl)-(3-fluorophenyl)methyl]amino]acetamide (PubChem CID 8719979) has the molecular formula C25H26FN3O2 and a molecular weight of 419.50 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-[[(R)-(4-ethylphenyl)-(3-fluorophenyl)methyl]amino]acetamide.
| Compound Name | N-(4-acetamidophenyl)-2-[[(R)-(4-ethylphenyl)-(3-fluorophenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 8719979 |
| Molecular Formula | C25H26FN3O2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-(4-acetamidophenyl)-2-[[(R)-(4-ethylphenyl)-(3-fluorophenyl)methyl]amino]acetamide |
| SMILES | CCc1ccc([C@@H](NCC(=O)Nc2ccc(NC(C)=O)cc2)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C25H26FN3O2/c1-3-18-7-9-19(10-8-18)25(20-5-4-6-21(26)15-20)27-16-24(31)29-23-13-11-22(12-14-23)28-17(2)30/h4-15,25,27H,3,16H2,1-2H3,(H,28,30)(H,29,31)/t25-/m1/s1 |
| InChIKey | SJZIZWXGYOPQLT-RUZDIDTESA-N |
| XLogP | 4.66 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |