C25H27FN2O3 — CID 60537379
N-(3,4-diethoxyphenyl)-2-[[(4-fluorophenyl)-phenylmethyl]amino]acetamide (PubChem CID 60537379) has the molecular formula C25H27FN2O3 and a molecular weight of 422.50 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-2-[[(4-fluorophenyl)-phenylmethyl]amino]acetamide.
| Compound Name | N-(3,4-diethoxyphenyl)-2-[[(4-fluorophenyl)-phenylmethyl]amino]acetamide |
|---|---|
| PubChem CID | 60537379 |
| Molecular Formula | C25H27FN2O3 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-2-[[(4-fluorophenyl)-phenylmethyl]amino]acetamide |
| SMILES | CCOc1ccc(NC(=O)CNC(c2ccccc2)c2ccc(F)cc2)cc1OCC |
| InChI | InChI=1S/C25H27FN2O3/c1-3-30-22-15-14-21(16-23(22)31-4-2)28-24(29)17-27-25(18-8-6-5-7-9-18)19-10-12-20(26)13-11-19/h5-16,25,27H,3-4,17H2,1-2H3,(H,28,29) |
| InChIKey | ABHQVRDXIVHKCF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |