C18H19F2NO3S — CID 9046452
N-(3,4-diethoxyphenyl)-2-(2,4-difluorophenyl)sulfanylacetamide (PubChem CID 9046452) has the molecular formula C18H19F2NO3S and a molecular weight of 367.42 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-2-(2,4-difluorophenyl)sulfanylacetamide.
| Compound Name | N-(3,4-diethoxyphenyl)-2-(2,4-difluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 9046452 |
| Molecular Formula | C18H19F2NO3S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-2-(2,4-difluorophenyl)sulfanylacetamide |
| SMILES | CCOc1ccc(NC(=O)CSc2ccc(F)cc2F)cc1OCC |
| InChI | InChI=1S/C18H19F2NO3S/c1-3-23-15-7-6-13(10-16(15)24-4-2)21-18(22)11-25-17-8-5-12(19)9-14(17)20/h5-10H,3-4,11H2,1-2H3,(H,21,22) |
| InChIKey | SPOWRMRWUVATRV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |