C18H19Cl2NO3S — CID 7466998
2-(2,6-dichlorophenyl)sulfanyl-N-(3,4-diethoxyphenyl)acetamide (PubChem CID 7466998) has the molecular formula C18H19Cl2NO3S and a molecular weight of 400.33 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)sulfanyl-N-(3,4-diethoxyphenyl)acetamide.
| Compound Name | 2-(2,6-dichlorophenyl)sulfanyl-N-(3,4-diethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 7466998 |
| Molecular Formula | C18H19Cl2NO3S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2-(2,6-dichlorophenyl)sulfanyl-N-(3,4-diethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CSc2c(Cl)cccc2Cl)cc1OCC |
| InChI | InChI=1S/C18H19Cl2NO3S/c1-3-23-15-9-8-12(10-16(15)24-4-2)21-17(22)11-25-18-13(19)6-5-7-14(18)20/h5-10H,3-4,11H2,1-2H3,(H,21,22) |
| InChIKey | ZMLAXVOQFLFITR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |