C14H19N5O3S — CID 8021977
N-(3,4-diethoxyphenyl)-2-(1-methyltetrazol-5-yl)sulfanylacetamide (PubChem CID 8021977) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-2-(1-methyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-(3,4-diethoxyphenyl)-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 8021977 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
| SMILES | CCOc1ccc(NC(=O)CSc2nnnn2C)cc1OCC |
| InChI | InChI=1S/C14H19N5O3S/c1-4-21-11-7-6-10(8-12(11)22-5-2)15-13(20)9-23-14-16-17-18-19(14)3/h6-8H,4-5,9H2,1-3H3,(H,15,20) |
| InChIKey | OIPBRAIJLOAWHW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |