C19H21FN2O4S — CID 7964597
N-[(3,4-diethoxyphenyl)carbamoyl]-2-(2-fluorophenyl)sulfanylacetamide (PubChem CID 7964597) has the molecular formula C19H21FN2O4S and a molecular weight of 392.45 g/mol. Its IUPAC name is N-[(3,4-diethoxyphenyl)carbamoyl]-2-(2-fluorophenyl)sulfanylacetamide.
| Compound Name | N-[(3,4-diethoxyphenyl)carbamoyl]-2-(2-fluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 7964597 |
| Molecular Formula | C19H21FN2O4S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[(3,4-diethoxyphenyl)carbamoyl]-2-(2-fluorophenyl)sulfanylacetamide |
| SMILES | CCOc1ccc(NC(=O)NC(=O)CSc2ccccc2F)cc1OCC |
| InChI | InChI=1S/C19H21FN2O4S/c1-3-25-15-10-9-13(11-16(15)26-4-2)21-19(24)22-18(23)12-27-17-8-6-5-7-14(17)20/h5-11H,3-4,12H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | MBYSMYSLYNWNJE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |