C18H21N3O5S — CID 8605339
N-[(3,4-diethoxyphenyl)carbamoyl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide (PubChem CID 8605339) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-[(3,4-diethoxyphenyl)carbamoyl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide.
| Compound Name | N-[(3,4-diethoxyphenyl)carbamoyl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 8605339 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-[(3,4-diethoxyphenyl)carbamoyl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide |
| SMILES | CCOc1ccc(NC(=O)NC(=O)CSc2cccc[n+]2[O-])cc1OCC |
| InChI | InChI=1S/C18H21N3O5S/c1-3-25-14-9-8-13(11-15(14)26-4-2)19-18(23)20-16(22)12-27-17-7-5-6-10-21(17)24/h5-11H,3-4,12H2,1-2H3,(H2,19,20,22,23) |
| InChIKey | YDXBHMIGOANYLS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|