C23H24N2O3 — CID 108867070
1-(3,4-diethoxyphenyl)-3-(4-phenylphenyl)urea (PubChem CID 108867070) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)-3-(4-phenylphenyl)urea.
| Compound Name | 1-(3,4-diethoxyphenyl)-3-(4-phenylphenyl)urea |
|---|---|
| PubChem CID | 108867070 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)-3-(4-phenylphenyl)urea |
| SMILES | CCOc1ccc(NC(=O)Nc2ccc(-c3ccccc3)cc2)cc1OCC |
| InChI | InChI=1S/C23H24N2O3/c1-3-27-21-15-14-20(16-22(21)28-4-2)25-23(26)24-19-12-10-18(11-13-19)17-8-6-5-7-9-17/h5-16H,3-4H2,1-2H3,(H2,24,25,26) |
| InChIKey | UIZZLFTUZDFANI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |