C34H38N2O4 — CID 23019231
1-[4-benzhydryloxy-3-(2-methylpropyl)phenyl]-3-(3,4-diethoxyphenyl)urea (PubChem CID 23019231) has the molecular formula C34H38N2O4 and a molecular weight of 538.69 g/mol. Its IUPAC name is 1-[4-benzhydryloxy-3-(2-methylpropyl)phenyl]-3-(3,4-diethoxyphenyl)urea.
| Compound Name | 1-[4-benzhydryloxy-3-(2-methylpropyl)phenyl]-3-(3,4-diethoxyphenyl)urea |
|---|---|
| PubChem CID | 23019231 |
| Molecular Formula | C34H38N2O4 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | 1-[4-benzhydryloxy-3-(2-methylpropyl)phenyl]-3-(3,4-diethoxyphenyl)urea |
| SMILES | CCOc1ccc(NC(=O)Nc2ccc(OC(c3ccccc3)c3ccccc3)c(CC(C)C)c2)cc1OCC |
| InChI | InChI=1S/C34H38N2O4/c1-5-38-31-20-18-29(23-32(31)39-6-2)36-34(37)35-28-17-19-30(27(22-28)21-24(3)4)40-33(25-13-9-7-10-14-25)26-15-11-8-12-16-26/h7-20,22-24,33H,5-6,21H2,1-4H3,(H2,35,36,37) |
| InChIKey | IGLDZWSQHGTSDJ-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |