C21H22N2O4 — CID 166327902
1-(3-ethoxy-4-methoxyphenyl)-3-(4-methoxynaphthalen-2-yl)urea (PubChem CID 166327902) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-(3-ethoxy-4-methoxyphenyl)-3-(4-methoxynaphthalen-2-yl)urea.
| Compound Name | 1-(3-ethoxy-4-methoxyphenyl)-3-(4-methoxynaphthalen-2-yl)urea |
|---|---|
| PubChem CID | 166327902 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-(3-ethoxy-4-methoxyphenyl)-3-(4-methoxynaphthalen-2-yl)urea |
| SMILES | CCOc1cc(NC(=O)Nc2cc(OC)c3ccccc3c2)ccc1OC |
| InChI | InChI=1S/C21H22N2O4/c1-4-27-20-12-15(9-10-18(20)25-2)22-21(24)23-16-11-14-7-5-6-8-17(14)19(13-16)26-3/h5-13H,4H2,1-3H3,(H2,22,23,24) |
| InChIKey | NQQSAOMBKWNMSL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |