C24H25N3O4 — CID 2330748
1-(9-ethylcarbazol-3-yl)-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 2330748) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 1-(9-ethylcarbazol-3-yl)-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-(9-ethylcarbazol-3-yl)-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 2330748 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 1-(9-ethylcarbazol-3-yl)-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)Nc3cc(OC)c(OC)c(OC)c3)ccc21 |
| InChI | InChI=1S/C24H25N3O4/c1-5-27-19-9-7-6-8-17(19)18-12-15(10-11-20(18)27)25-24(28)26-16-13-21(29-2)23(31-4)22(14-16)30-3/h6-14H,5H2,1-4H3,(H2,25,26,28) |
| InChIKey | NCLJRQGBAMLFLD-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |