C31H36N4O6 — CID 4566264
N-(9-ethylcarbazol-3-yl)-3,3-dimethyl-5-oxo-5-[2-(3,4,5-trimethoxybenzoyl)hydrazinyl]pentanamide (PubChem CID 4566264) has the molecular formula C31H36N4O6 and a molecular weight of 560.65 g/mol. Its IUPAC name is N-(9-ethylcarbazol-3-yl)-3,3-dimethyl-5-oxo-5-[2-(3,4,5-trimethoxybenzoyl)hydrazinyl]pentanamide.
| Compound Name | N-(9-ethylcarbazol-3-yl)-3,3-dimethyl-5-oxo-5-[2-(3,4,5-trimethoxybenzoyl)hydrazinyl]pentanamide |
|---|---|
| PubChem CID | 4566264 |
| Molecular Formula | C31H36N4O6 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | N-(9-ethylcarbazol-3-yl)-3,3-dimethyl-5-oxo-5-[2-(3,4,5-trimethoxybenzoyl)hydrazinyl]pentanamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)CC(C)(C)CC(=O)NNC(=O)c3cc(OC)c(OC)c(OC)c3)ccc21 |
| InChI | InChI=1S/C31H36N4O6/c1-7-35-23-11-9-8-10-21(23)22-16-20(12-13-24(22)35)32-27(36)17-31(2,3)18-28(37)33-34-30(38)19-14-25(39-4)29(41-6)26(15-19)40-5/h8-16H,7,17-18H2,1-6H3,(H,32,36)(H,33,37)(H,34,38) |
| InChIKey | HIZYIWBQHDBHEU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|