C21H33N3O6 — CID 3955560
N,N-diethyl-3,3-dimethyl-5-oxo-5-[2-(3,4,5-trimethoxybenzoyl)hydrazinyl]pentanamide (PubChem CID 3955560) has the molecular formula C21H33N3O6 and a molecular weight of 423.51 g/mol. Its IUPAC name is N,N-diethyl-3,3-dimethyl-5-oxo-5-[2-(3,4,5-trimethoxybenzoyl)hydrazinyl]pentanamide.
| Compound Name | N,N-diethyl-3,3-dimethyl-5-oxo-5-[2-(3,4,5-trimethoxybenzoyl)hydrazinyl]pentanamide |
|---|---|
| PubChem CID | 3955560 |
| Molecular Formula | C21H33N3O6 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | N,N-diethyl-3,3-dimethyl-5-oxo-5-[2-(3,4,5-trimethoxybenzoyl)hydrazinyl]pentanamide |
| SMILES | CCN(CC)C(=O)CC(C)(C)CC(=O)NNC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H33N3O6/c1-8-24(9-2)18(26)13-21(3,4)12-17(25)22-23-20(27)14-10-15(28-5)19(30-7)16(11-14)29-6/h10-11H,8-9,12-13H2,1-7H3,(H,22,25)(H,23,27) |
| InChIKey | ASYIEQPRXIYRFD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|