C18H26N2O5 — CID 4043294
N'-(3-cyclopentylpropanoyl)-3,4,5-trimethoxybenzohydrazide (PubChem CID 4043294) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is N'-(3-cyclopentylpropanoyl)-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-(3-cyclopentylpropanoyl)-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 4043294 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | N'-(3-cyclopentylpropanoyl)-3,4,5-trimethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)CCC2CCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C18H26N2O5/c1-23-14-10-13(11-15(24-2)17(14)25-3)18(22)20-19-16(21)9-8-12-6-4-5-7-12/h10-12H,4-9H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | NGYPNYPTAHQAPG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|