C18H28N3O5+ — CID 7448564
3,4,5-trimethoxy-N'-(3-piperidin-1-ium-1-ylpropanoyl)benzohydrazide (PubChem CID 7448564) has the molecular formula C18H28N3O5+ and a molecular weight of 366.44 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N'-(3-piperidin-1-ium-1-ylpropanoyl)benzohydrazide.
| Compound Name | 3,4,5-trimethoxy-N'-(3-piperidin-1-ium-1-ylpropanoyl)benzohydrazide |
|---|---|
| PubChem CID | 7448564 |
| Molecular Formula | C18H28N3O5+ |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 3,4,5-trimethoxy-N'-(3-piperidin-1-ium-1-ylpropanoyl)benzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)CC[NH+]2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C18H27N3O5/c1-24-14-11-13(12-15(25-2)17(14)26-3)18(23)20-19-16(22)7-10-21-8-5-4-6-9-21/h11-12H,4-10H2,1-3H3,(H,19,22)(H,20,23)/p+1 |
| InChIKey | QHMOYQDSYZBVNR-UHFFFAOYSA-O |
| XLogP | -0.07 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|