C29H40N4O10 — CID 3801032
1-N',9-N'-bis(3,4,5-trimethoxybenzoyl)nonanedihydrazide (PubChem CID 3801032) has the molecular formula C29H40N4O10 and a molecular weight of 604.66 g/mol. Its IUPAC name is 1-N',9-N'-bis(3,4,5-trimethoxybenzoyl)nonanedihydrazide.
| Compound Name | 1-N',9-N'-bis(3,4,5-trimethoxybenzoyl)nonanedihydrazide |
|---|---|
| PubChem CID | 3801032 |
| Molecular Formula | C29H40N4O10 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | 1-N',9-N'-bis(3,4,5-trimethoxybenzoyl)nonanedihydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)CCCCCCCC(=O)NNC(=O)c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C29H40N4O10/c1-38-20-14-18(15-21(39-2)26(20)42-5)28(36)32-30-24(34)12-10-8-7-9-11-13-25(35)31-33-29(37)19-16-22(40-3)27(43-6)23(17-19)41-4/h14-17H,7-13H2,1-6H3,(H,30,34)(H,31,35)(H,32,36)(H,33,37) |
| InChIKey | ARBSLXZFFDJTKI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 171.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|