C25H30Br2N4O6 — CID 5241473
1-N',9-N'-bis(3-bromo-4-methoxybenzoyl)nonanedihydrazide (PubChem CID 5241473) has the molecular formula C25H30Br2N4O6 and a molecular weight of 642.35 g/mol. Its IUPAC name is 1-N',9-N'-bis(3-bromo-4-methoxybenzoyl)nonanedihydrazide.
| Compound Name | 1-N',9-N'-bis(3-bromo-4-methoxybenzoyl)nonanedihydrazide |
|---|---|
| PubChem CID | 5241473 |
| Molecular Formula | C25H30Br2N4O6 |
| Molecular Weight | 642.35 g/mol |
| Exact Mass | 640.05 |
| IUPAC Name | 1-N',9-N'-bis(3-bromo-4-methoxybenzoyl)nonanedihydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)CCCCCCCC(=O)NNC(=O)c2ccc(OC)c(Br)c2)cc1Br |
| InChI | InChI=1S/C25H30Br2N4O6/c1-36-20-12-10-16(14-18(20)26)24(34)30-28-22(32)8-6-4-3-5-7-9-23(33)29-31-25(35)17-11-13-21(37-2)19(27)15-17/h10-15H,3-9H2,1-2H3,(H,28,32)(H,29,33)(H,30,34)(H,31,35) |
| InChIKey | BCZFCXQDUNSBHH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|