C17H16BrN3O4 — CID 5119214
N-[4-[[(3-bromo-4-methoxybenzoyl)amino]carbamoyl]phenyl]acetamide (PubChem CID 5119214) has the molecular formula C17H16BrN3O4 and a molecular weight of 406.24 g/mol. Its IUPAC name is N-[4-[[(3-bromo-4-methoxybenzoyl)amino]carbamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[(3-bromo-4-methoxybenzoyl)amino]carbamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 5119214 |
| Molecular Formula | C17H16BrN3O4 |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | N-[4-[[(3-bromo-4-methoxybenzoyl)amino]carbamoyl]phenyl]acetamide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2ccc(NC(C)=O)cc2)cc1Br |
| InChI | InChI=1S/C17H16BrN3O4/c1-10(22)19-13-6-3-11(4-7-13)16(23)20-21-17(24)12-5-8-15(25-2)14(18)9-12/h3-9H,1-2H3,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | RCWGWCQYIMFHFU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|