About 3-bromo-4-methoxy-N'-methylbenzohydrazide
3-bromo-4-methoxy-N'-methylbenzohydrazide (PubChem CID 116846856) has the molecular formula C9H11BrN2O2
and a molecular weight of 259.10 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N'-methylbenzohydrazide.
Molecular Properties
| Compound Name | 3-bromo-4-methoxy-N'-methylbenzohydrazide |
| PubChem CID | 116846856 |
| Molecular Formula | C9H11BrN2O2 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 3-bromo-4-methoxy-N'-methylbenzohydrazide |
| SMILES | CNNC(=O)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C9H11BrN2O2/c1-11-12-9(13)6-3-4-8(14-2)7(10)5-6/h3-5,11H,1-2H3,(H,12,13) |
| InChIKey | YMUAOFPOFVDTDE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-methoxy-N'-methylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-methoxy-N'-methylbenzohydrazide?
The IUPAC name of 3-bromo-4-methoxy-N'-methylbenzohydrazide (CID 116846856) is 3-bromo-4-methoxy-N'-methylbenzohydrazide.
What is the SMILES notation for 3-bromo-4-methoxy-N'-methylbenzohydrazide?
The canonical SMILES for 3-bromo-4-methoxy-N'-methylbenzohydrazide is CNNC(=O)c1ccc(OC)c(Br)c1.
What is the InChIKey of 3-bromo-4-methoxy-N'-methylbenzohydrazide?
The InChIKey is YMUAOFPOFVDTDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrN2O2/c1-11-12-9(13)6-3-4-8(14-2)7(10)5-6/h3-5,11H,1-2H3,(H,12,13).
What are the key properties of 3-bromo-4-methoxy-N'-methylbenzohydrazide?
3-bromo-4-methoxy-N'-methylbenzohydrazide has a molecular weight of 259.10 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-methoxy-N'-methylbenzohydrazide is sourced from PubChem (CID 116846856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).